C10H20N2O3S — CID 165486972
2-methyl-4-methylsulfonyl-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 165486972) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-methyl-4-methylsulfonyl-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | 2-methyl-4-methylsulfonyl-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 165486972 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-methyl-4-methylsulfonyl-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | CC1CN(S(C)(=O)=O)CC2(CCNCC2)O1 |
| InChI | InChI=1S/C10H20N2O3S/c1-9-7-12(16(2,13)14)8-10(15-9)3-5-11-6-4-10/h9,11H,3-8H2,1-2H3 |
| InChIKey | DTDYFOKIJCKJSQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |