C28H36N2O5 — CID 165480760
2-[[4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-5-methylhexanoyl]amino]butanoic acid (PubChem CID 165480760) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[[4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-5-methylhexanoyl]amino]butanoic acid.
| Compound Name | 2-[[4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-5-methylhexanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 165480760 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-[[4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-5-methylhexanoyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)CCC(CCNC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C)C(=O)O |
| InChI | InChI=1S/C28H36N2O5/c1-4-25(27(32)33)30-26(31)14-13-19(18(2)3)15-16-29-28(34)35-17-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-12,18-19,24-25H,4,13-17H2,1-3H3,(H,29,34)(H,30,31)(H,32,33) |
| InChIKey | FFCFQQJYJVOSJE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |