C26H23ClN2O5 — CID 165485744
4-(2-chloro-5-methylanilino)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (PubChem CID 165485744) has the molecular formula C26H23ClN2O5 and a molecular weight of 478.93 g/mol. Its IUPAC name is 4-(2-chloro-5-methylanilino)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid.
| Compound Name | 4-(2-chloro-5-methylanilino)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 165485744 |
| Molecular Formula | C26H23ClN2O5 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 4-(2-chloro-5-methylanilino)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| SMILES | Cc1ccc(Cl)c(NC(=O)C(CC(=O)O)NC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C26H23ClN2O5/c1-15-10-11-21(27)22(12-15)28-25(32)23(13-24(30)31)29-26(33)34-14-20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)20/h2-12,20,23H,13-14H2,1H3,(H,28,32)(H,29,33)(H,30,31) |
| InChIKey | AYLDPMPBWPEHDA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |