2-(propanoylamino)-1,3-oxazole-5-carboxylic acid

C7H8N2O4 — CID 165486197

IUPAC2-(propanoylamino)-1,3-oxazole-5-carboxylic acid
SMILESCCC(=O)Nc1ncc(C(=O)O)o1
InChIInChI=1S/C7H8N2O4/c1-2-5(10)9-7-8-3-4(13-7)6(11)12/h3H,2H2,1H3,(H,11,12)(H,8,9,10)
InChIKeyDNACABDTGQHQDK-UHFFFAOYSA-N
MW184.15 g/mol
LogP0.72
Rot. Bonds3

About 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid

2-(propanoylamino)-1,3-oxazole-5-carboxylic acid (PubChem CID 165486197) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(propanoylamino)-1,3-oxazole-5-carboxylic acid
PubChem CID165486197
Molecular FormulaC7H8N2O4
Molecular Weight184.15 g/mol
Exact Mass184.05
IUPAC Name2-(propanoylamino)-1,3-oxazole-5-carboxylic acid
SMILESCCC(=O)Nc1ncc(C(=O)O)o1
InChIInChI=1S/C7H8N2O4/c1-2-5(10)9-7-8-3-4(13-7)6(11)12/h3H,2H2,1H3,(H,11,12)(H,8,9,10)
InChIKeyDNACABDTGQHQDK-UHFFFAOYSA-N
XLogP0.72
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 50.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid (CID 165486197) is 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid is CCC(=O)Nc1ncc(C(=O)O)o1.
What is the InChIKey of 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid?
The InChIKey is DNACABDTGQHQDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-2-5(10)9-7-8-3-4(13-7)6(11)12/h3H,2H2,1H3,(H,11,12)(H,8,9,10).
What are the key properties of 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid?
2-(propanoylamino)-1,3-oxazole-5-carboxylic acid has a molecular weight of 184.15 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propanoylamino)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 165486197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).