C5H4BNO3 — CID 164907588
CID 164907588 (PubChem CID 164907588) has the molecular formula C5H4BNO3 and a molecular weight of 136.90 g/mol.
| Compound Name | CID 164907588 |
|---|---|
| PubChem CID | 164907588 |
| Molecular Formula | C5H4BNO3 |
| Molecular Weight | 136.90 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | — |
| SMILES | [B]Cc1ncc(C(=O)O)o1 |
| InChI | InChI=1S/C5H4BNO3/c6-1-4-7-2-3(10-4)5(8)9/h2H,1H2,(H,8,9) |
| InChIKey | NGURQDKDHVBDPF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.90 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|