C10H16N2O4S — CID 165486634
2,6-dimethoxy-N-propan-2-ylpyridine-3-sulfonamide (PubChem CID 165486634) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 2,6-dimethoxy-N-propan-2-ylpyridine-3-sulfonamide.
| Compound Name | 2,6-dimethoxy-N-propan-2-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 165486634 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2,6-dimethoxy-N-propan-2-ylpyridine-3-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C)c(OC)n1 |
| InChI | InChI=1S/C10H16N2O4S/c1-7(2)12-17(13,14)8-5-6-9(15-3)11-10(8)16-4/h5-7,12H,1-4H3 |
| InChIKey | JCKRJRWHBIBVFM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |