C11H23NO3S — CID 165487230
cis-(1S,2R)-2-methoxy-N-propan-2-ylcycloheptane-1-sulfonamide (PubChem CID 165487230) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is cis-(1S,2R)-2-methoxy-N-propan-2-ylcycloheptane-1-sulfonamide.
| Compound Name | cis-(1S,2R)-2-methoxy-N-propan-2-ylcycloheptane-1-sulfonamide |
|---|---|
| PubChem CID | 165487230 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | cis-(1S,2R)-2-methoxy-N-propan-2-ylcycloheptane-1-sulfonamide |
| SMILES | CO[C@@H]1CCCCC[C@@H]1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C11H23NO3S/c1-9(2)12-16(13,14)11-8-6-4-5-7-10(11)15-3/h9-12H,4-8H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | GXLSVQUQYHTXJK-MNOVXSKESA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |