C13H26N2O4S — CID 167882280
N'-(2-methoxycyclohexyl)sulfonyl-3,3-dimethylbutanehydrazide (PubChem CID 167882280) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is N'-(2-methoxycyclohexyl)sulfonyl-3,3-dimethylbutanehydrazide.
| Compound Name | N'-(2-methoxycyclohexyl)sulfonyl-3,3-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 167882280 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N'-(2-methoxycyclohexyl)sulfonyl-3,3-dimethylbutanehydrazide |
| SMILES | COC1CCCCC1S(=O)(=O)NNC(=O)CC(C)(C)C |
| InChI | InChI=1S/C13H26N2O4S/c1-13(2,3)9-12(16)14-15-20(17,18)11-8-6-5-7-10(11)19-4/h10-11,15H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | PMZZKXDOFGXEMW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|