C11H15N3OS2 — CID 165487597
7-methyl-2-(thian-4-yl)-6,7-dihydropyrazolo[3,4-e][1,3]oxazine-5-thione (PubChem CID 165487597) has the molecular formula C11H15N3OS2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 7-methyl-2-(thian-4-yl)-6,7-dihydropyrazolo[3,4-e][1,3]oxazine-5-thione.
| Compound Name | 7-methyl-2-(thian-4-yl)-6,7-dihydropyrazolo[3,4-e][1,3]oxazine-5-thione |
|---|---|
| PubChem CID | 165487597 |
| Molecular Formula | C11H15N3OS2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 7-methyl-2-(thian-4-yl)-6,7-dihydropyrazolo[3,4-e][1,3]oxazine-5-thione |
| SMILES | CC1NC(=S)Oc2cn(C3CCSCC3)nc21 |
| InChI | InChI=1S/C11H15N3OS2/c1-7-10-9(15-11(16)12-7)6-14(13-10)8-2-4-17-5-3-8/h6-8H,2-5H2,1H3,(H,12,16) |
| InChIKey | MPGQWCQLARNFLW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|