C10H18N2O2 — CID 165491011
2-amino-2-(2,2-dimethyl-5-oxocyclohexyl)acetamide (PubChem CID 165491011) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-amino-2-(2,2-dimethyl-5-oxocyclohexyl)acetamide.
| Compound Name | 2-amino-2-(2,2-dimethyl-5-oxocyclohexyl)acetamide |
|---|---|
| PubChem CID | 165491011 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-amino-2-(2,2-dimethyl-5-oxocyclohexyl)acetamide |
| SMILES | CC1(C)CCC(=O)CC1C(N)C(N)=O |
| InChI | InChI=1S/C10H18N2O2/c1-10(2)4-3-6(13)5-7(10)8(11)9(12)14/h7-8H,3-5,11H2,1-2H3,(H2,12,14) |
| InChIKey | XRAQTTUVHBICFX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |