C10H18O2 — CID 165496997
3-(methoxymethyl)-4,4-dimethylcyclohexan-1-one (PubChem CID 165496997) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-(methoxymethyl)-4,4-dimethylcyclohexan-1-one.
| Compound Name | 3-(methoxymethyl)-4,4-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 165496997 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3-(methoxymethyl)-4,4-dimethylcyclohexan-1-one |
| SMILES | COCC1CC(=O)CCC1(C)C |
| InChI | InChI=1S/C10H18O2/c1-10(2)5-4-9(11)6-8(10)7-12-3/h8H,4-7H2,1-3H3 |
| InChIKey | JHVULGZZIAZKHC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |