C12H17NOS — CID 165497048
4,4-dimethyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-one (PubChem CID 165497048) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 4,4-dimethyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-one.
| Compound Name | 4,4-dimethyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 165497048 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 4,4-dimethyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-one |
| SMILES | CC1(C)CCC(=O)CC1Cc1nccs1 |
| InChI | InChI=1S/C12H17NOS/c1-12(2)4-3-10(14)7-9(12)8-11-13-5-6-15-11/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | HTNGHQQTGCDEFJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |