C12H22OS — CID 165496420
3-tert-butylsulfanyl-4,4-dimethylcyclohexan-1-one (PubChem CID 165496420) has the molecular formula C12H22OS and a molecular weight of 214.37 g/mol. Its IUPAC name is 3-tert-butylsulfanyl-4,4-dimethylcyclohexan-1-one.
| Compound Name | 3-tert-butylsulfanyl-4,4-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 165496420 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 3-tert-butylsulfanyl-4,4-dimethylcyclohexan-1-one |
| SMILES | CC(C)(C)SC1CC(=O)CCC1(C)C |
| InChI | InChI=1S/C12H22OS/c1-11(2,3)14-10-8-9(13)6-7-12(10,4)5/h10H,6-8H2,1-5H3 |
| InChIKey | KLZMKGJTKQOVDR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |