C11H19NO3 — CID 175544649
(1,2,2-trimethyl-4-oxocyclohexyl)methyl carbamate (PubChem CID 175544649) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (1,2,2-trimethyl-4-oxocyclohexyl)methyl carbamate.
| Compound Name | (1,2,2-trimethyl-4-oxocyclohexyl)methyl carbamate |
|---|---|
| PubChem CID | 175544649 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (1,2,2-trimethyl-4-oxocyclohexyl)methyl carbamate |
| SMILES | CC1(C)CC(=O)CCC1(C)COC(N)=O |
| InChI | InChI=1S/C11H19NO3/c1-10(2)6-8(13)4-5-11(10,3)7-15-9(12)14/h4-7H2,1-3H3,(H2,12,14) |
| InChIKey | XRHUXLLSTDCKPG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |