C24H25ClN2O3 — CID 16552654
N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N-ethyl-3-(5-phenylfuran-2-yl)propanamide (PubChem CID 16552654) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N-ethyl-3-(5-phenylfuran-2-yl)propanamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N-ethyl-3-(5-phenylfuran-2-yl)propanamide |
|---|---|
| PubChem CID | 16552654 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N-ethyl-3-(5-phenylfuran-2-yl)propanamide |
| SMILES | CCN(CC(=O)NCc1ccc(Cl)cc1)C(=O)CCc1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H25ClN2O3/c1-2-27(17-23(28)26-16-18-8-10-20(25)11-9-18)24(29)15-13-21-12-14-22(30-21)19-6-4-3-5-7-19/h3-12,14H,2,13,15-17H2,1H3,(H,26,28) |
| InChIKey | KEGQCGUOBNOJRO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |