C19H21BrN2O4 — CID 16576313
3-[N-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-methoxyanilino]propanamide (PubChem CID 16576313) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is 3-[N-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-methoxyanilino]propanamide.
| Compound Name | 3-[N-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-methoxyanilino]propanamide |
|---|---|
| PubChem CID | 16576313 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 3-[N-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-methoxyanilino]propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)Cc2cc3c(cc2Br)OCCO3)cc1 |
| InChI | InChI=1S/C19H21BrN2O4/c1-24-15-4-2-14(3-5-15)22(7-6-19(21)23)12-13-10-17-18(11-16(13)20)26-9-8-25-17/h2-5,10-11H,6-9,12H2,1H3,(H2,21,23) |
| InChIKey | ZWQDIDDQSPURCN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|