C22H19FN2O6 — CID 16596086
[1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 16596086) has the molecular formula C22H19FN2O6 and a molecular weight of 426.40 g/mol. Its IUPAC name is [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] (E)-3-(2-nitrophenyl)prop-2-enoate.
| Compound Name | [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] (E)-3-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16596086 |
| Molecular Formula | C22H19FN2O6 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])OC1CCCCN(C(=O)c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C22H19FN2O6/c23-17-11-8-16(9-12-17)21(27)24-14-4-3-7-19(22(24)28)31-20(26)13-10-15-5-1-2-6-18(15)25(29)30/h1-2,5-6,8-13,19H,3-4,7,14H2/b13-10+ |
| InChIKey | MAFDZTQOAQOWNN-JLHYYAGUSA-N |
| XLogP | 3.51 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|