About [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate
[1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate (PubChem CID 42915280) has the molecular formula C22H23FN2O5S
and a molecular weight of 446.50 g/mol. Its IUPAC name is [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
Molecular Properties
| Compound Name | [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| PubChem CID | 42915280 |
| Molecular Formula | C22H23FN2O5S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CC(=O)Nc1sc(C)c(C)c1C(=O)OC1CCCCN(C(=O)c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C22H23FN2O5S/c1-12-13(2)31-19(24-14(3)26)18(12)22(29)30-17-6-4-5-11-25(21(17)28)20(27)15-7-9-16(23)10-8-15/h7-10,17H,4-6,11H2,1-3H3,(H,24,26) |
| InChIKey | KSMZFNDADBYBBG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate?
The IUPAC name of [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate (CID 42915280) is [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
What is the SMILES notation for [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate?
The canonical SMILES for [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate is CC(=O)Nc1sc(C)c(C)c1C(=O)OC1CCCCN(C(=O)c2ccc(F)cc2)C1=O.
What is the InChIKey of [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate?
The InChIKey is KSMZFNDADBYBBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23FN2O5S/c1-12-13(2)31-19(24-14(3)26)18(12)22(29)30-17-6-4-5-11-25(21(17)28)20(27)15-7-9-16(23)10-8-15/h7-10,17H,4-6,11H2,1-3H3,(H,24,26).
What are the key properties of [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate?
[1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate has a molecular weight of 446.50 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate is sourced from PubChem (CID 42915280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).