C7H14F2S2 — CID 166005111
(3R)-1,1-difluoro-4-methyl-3-(methyldisulfanyl)pentane (PubChem CID 166005111) has the molecular formula C7H14F2S2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (3R)-1,1-difluoro-4-methyl-3-(methyldisulfanyl)pentane.
| Compound Name | (3R)-1,1-difluoro-4-methyl-3-(methyldisulfanyl)pentane |
|---|---|
| PubChem CID | 166005111 |
| Molecular Formula | C7H14F2S2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (3R)-1,1-difluoro-4-methyl-3-(methyldisulfanyl)pentane |
| SMILES | CSS[C@H](CC(F)F)C(C)C |
| InChI | InChI=1S/C7H14F2S2/c1-5(2)6(11-10-3)4-7(8)9/h5-7H,4H2,1-3H3/t6-/m1/s1 |
| InChIKey | XXSJYDMDILWARY-ZCFIWIBFSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|