C10H8O6S — CID 166013262
1,3-dihydroxy-4-oxonaphthalene-1-sulfonic acid (PubChem CID 166013262) has the molecular formula C10H8O6S and a molecular weight of 256.23 g/mol. Its IUPAC name is 1,3-dihydroxy-4-oxonaphthalene-1-sulfonic acid.
| Compound Name | 1,3-dihydroxy-4-oxonaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 166013262 |
| Molecular Formula | C10H8O6S |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 1,3-dihydroxy-4-oxonaphthalene-1-sulfonic acid |
| SMILES | O=C1C(O)=CC(O)(S(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C10H8O6S/c11-8-5-10(13,17(14,15)16)7-4-2-1-3-6(7)9(8)12/h1-5,11,13H,(H,14,15,16) |
| InChIKey | WXUOVQATOCFIRJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|