C17H27N5O4 — CID 166015435
ethyl 2-[(2R,3S,5R)-2-(6-amino-4,5-dihydropurin-9-yl)-4,5-diethyloxolan-3-yl]oxyacetate (PubChem CID 166015435) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl 2-[(2R,3S,5R)-2-(6-amino-4,5-dihydropurin-9-yl)-4,5-diethyloxolan-3-yl]oxyacetate.
| Compound Name | ethyl 2-[(2R,3S,5R)-2-(6-amino-4,5-dihydropurin-9-yl)-4,5-diethyloxolan-3-yl]oxyacetate |
|---|---|
| PubChem CID | 166015435 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | ethyl 2-[(2R,3S,5R)-2-(6-amino-4,5-dihydropurin-9-yl)-4,5-diethyloxolan-3-yl]oxyacetate |
| SMILES | CCOC(=O)CO[C@H]1C(CC)[C@@H](CC)O[C@H]1N1C=NC2C(N)=NC=NC21 |
| InChI | InChI=1S/C17H27N5O4/c1-4-10-11(5-2)26-17(14(10)25-7-12(23)24-6-3)22-9-21-13-15(18)19-8-20-16(13)22/h8-11,13-14,16-17H,4-7H2,1-3H3,(H2,18,19,20)/t10?,11-,13?,14+,16?,17-/m1/s1 |
| InChIKey | CLLAYVDYUCDLKE-WTEPHDRDSA-N |
| XLogP | 0.53 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |