C11H17N5O4 — CID 166776153
2-(hydroxymethyl)-5-(6-methylimino-4,5-dihydro-1H-purin-9-yl)oxolane-3,4-diol (PubChem CID 166776153) has the molecular formula C11H17N5O4 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-(6-methylimino-4,5-dihydro-1H-purin-9-yl)oxolane-3,4-diol.
| Compound Name | 2-(hydroxymethyl)-5-(6-methylimino-4,5-dihydro-1H-purin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 166776153 |
| Molecular Formula | C11H17N5O4 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(hydroxymethyl)-5-(6-methylimino-4,5-dihydro-1H-purin-9-yl)oxolane-3,4-diol |
| SMILES | C/N=C1\NC=NC2C1N=CN2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C11H17N5O4/c1-12-9-6-10(14-3-13-9)16(4-15-6)11-8(19)7(18)5(2-17)20-11/h3-8,10-11,17-19H,2H2,1H3,(H,12,13,14) |
| InChIKey | QRQHEUHYCZDLGH-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|