C17H21N5O4 — CID 149021880
(2R,5R)-2-(6-benzylimino-4,5-dihydro-1H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 149021880) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is (2R,5R)-2-(6-benzylimino-4,5-dihydro-1H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-benzylimino-4,5-dihydro-1H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 149021880 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2R,5R)-2-(6-benzylimino-4,5-dihydro-1H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](N2C=NC3/C(=N/Cc4ccccc4)NC=NC32)C(O)C1O |
| InChI | InChI=1S/C17H21N5O4/c23-7-11-13(24)14(25)17(26-11)22-9-21-12-15(19-8-20-16(12)22)18-6-10-4-2-1-3-5-10/h1-5,8-9,11-14,16-17,23-25H,6-7H2,(H,18,19,20)/t11-,12?,13?,14?,16?,17-/m1/s1 |
| InChIKey | QDPYDABZVDXEAC-FQIICHMXSA-N |
| XLogP | -1.31 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|