C17H19ClFN5O4 — CID 171471198
(2R,3S,4S,5R)-2-(2-benzylimino-3-chloro-4-fluoro-1H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 171471198) has the molecular formula C17H19ClFN5O4 and a molecular weight of 411.82 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(2-benzylimino-3-chloro-4-fluoro-1H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(2-benzylimino-3-chloro-4-fluoro-1H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 171471198 |
| Molecular Formula | C17H19ClFN5O4 |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (2R,3S,4S,5R)-2-(2-benzylimino-3-chloro-4-fluoro-1H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](N2C=NC3=CN/C(=N\Cc4ccccc4)N(Cl)C32F)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19ClFN5O4/c18-24-16(20-6-10-4-2-1-3-5-10)21-7-12-17(24,19)23(9-22-12)15-14(27)13(26)11(8-25)28-15/h1-5,7,9,11,13-15,25-27H,6,8H2,(H,20,21)/t11-,13-,14+,15-,17?/m1/s1 |
| InChIKey | QSFTZYHUZMQOEG-OJSFXMOISA-N |
| XLogP | -0.15 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|