C20H26N4O6 — CID 163607581
(2R,5R)-2-[4-(1,3-benzodioxol-5-ylmethylimino)-3,4a,5,6,7,8a-hexahydropyrido[2,3-d]pyrimidin-8-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 163607581) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is (2R,5R)-2-[4-(1,3-benzodioxol-5-ylmethylimino)-3,4a,5,6,7,8a-hexahydropyrido[2,3-d]pyrimidin-8-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[4-(1,3-benzodioxol-5-ylmethylimino)-3,4a,5,6,7,8a-hexahydropyrido[2,3-d]pyrimidin-8-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 163607581 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2R,5R)-2-[4-(1,3-benzodioxol-5-ylmethylimino)-3,4a,5,6,7,8a-hexahydropyrido[2,3-d]pyrimidin-8-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](N2CCCC3/C(=N/Cc4ccc5c(c4)OCO5)NC=NC32)C(O)C1O |
| InChI | InChI=1S/C20H26N4O6/c25-8-15-16(26)17(27)20(30-15)24-5-1-2-12-18(22-9-23-19(12)24)21-7-11-3-4-13-14(6-11)29-10-28-13/h3-4,6,9,12,15-17,19-20,25-27H,1-2,5,7-8,10H2,(H,21,22,23)/t12?,15-,16?,17?,19?,20-/m1/s1 |
| InChIKey | HDCGBFLXCGWYPC-HNMZGXNCSA-N |
| XLogP | -0.58 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|