C22H43N5O4Si2 — CID 10720127
[(2R,3R,4R,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methanol (PubChem CID 10720127) has the molecular formula C22H43N5O4Si2 and a molecular weight of 497.79 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 10720127 |
| Molecular Formula | C22H43N5O4Si2 |
| Molecular Weight | 497.79 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1N1C=NC2C(N)=NC=NC21 |
| InChI | InChI=1S/C22H43N5O4Si2/c1-21(2,3)32(7,8)30-16-14(11-28)29-20(17(16)31-33(9,10)22(4,5)6)27-13-26-15-18(23)24-12-25-19(15)27/h12-17,19-20,28H,11H2,1-10H3,(H2,23,24,25)/t14-,15?,16-,17-,19?,20-/m1/s1 |
| InChIKey | UZDGEAOQJTWSMQ-VDPBPCHWSA-N |
| XLogP | 2.92 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|