C15H24N6O3 — CID 10806793
9-[(3aR,4R,6R,6aR)-6-[(dimethylamino)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4,5-dihydropurin-6-amine (PubChem CID 10806793) has the molecular formula C15H24N6O3 and a molecular weight of 336.40 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-[(dimethylamino)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4,5-dihydropurin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-[(dimethylamino)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4,5-dihydropurin-6-amine |
|---|---|
| PubChem CID | 10806793 |
| Molecular Formula | C15H24N6O3 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-[(dimethylamino)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4,5-dihydropurin-6-amine |
| SMILES | CN(C)C[C@H]1O[C@@H](N2C=NC3C(N)=NC=NC32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C15H24N6O3/c1-15(2)23-10-8(5-20(3)4)22-14(11(10)24-15)21-7-19-9-12(16)17-6-18-13(9)21/h6-11,13-14H,5H2,1-4H3,(H2,16,17,18)/t8-,9?,10-,11-,13?,14-/m1/s1 |
| InChIKey | OXRLIOOGMSOLLM-SZBSRSIBSA-N |
| XLogP | -0.77 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |