C20H35N5O3 — CID 166015426
(2R,4S,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-2-ethyl-4-nonoxyoxolan-3-ol (PubChem CID 166015426) has the molecular formula C20H35N5O3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (2R,4S,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-2-ethyl-4-nonoxyoxolan-3-ol.
| Compound Name | (2R,4S,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-2-ethyl-4-nonoxyoxolan-3-ol |
|---|---|
| PubChem CID | 166015426 |
| Molecular Formula | C20H35N5O3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | (2R,4S,5R)-5-(6-amino-4,5-dihydropurin-9-yl)-2-ethyl-4-nonoxyoxolan-3-ol |
| SMILES | CCCCCCCCCO[C@H]1C(O)[C@@H](CC)O[C@H]1N1C=NC2C(N)=NC=NC21 |
| InChI | InChI=1S/C20H35N5O3/c1-3-5-6-7-8-9-10-11-27-17-16(26)14(4-2)28-20(17)25-13-24-15-18(21)22-12-23-19(15)25/h12-17,19-20,26H,3-11H2,1-2H3,(H2,21,22,23)/t14-,15?,16?,17+,19?,20-/m1/s1 |
| InChIKey | XYBZFVQSKZEALO-HEWGSVBCSA-N |
| XLogP | 2.06 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|