C26H34N4O6 — CID 166018740
5-O-tert-butyl 3-O-ethyl 6-ethenyl-2-[2-(phenylmethoxycarbonylamino)ethyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3,5-dicarboxylate (PubChem CID 166018740) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O-ethyl 6-ethenyl-2-[2-(phenylmethoxycarbonylamino)ethyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 3-O-ethyl 6-ethenyl-2-[2-(phenylmethoxycarbonylamino)ethyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 166018740 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 5-O-tert-butyl 3-O-ethyl 6-ethenyl-2-[2-(phenylmethoxycarbonylamino)ethyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3,5-dicarboxylate |
| SMILES | C=CC1Cc2nn(CCNC(=O)OCc3ccccc3)c(C(=O)OCC)c2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H34N4O6/c1-6-19-15-21-20(16-29(19)25(33)36-26(3,4)5)22(23(31)34-7-2)30(28-21)14-13-27-24(32)35-17-18-11-9-8-10-12-18/h6,8-12,19H,1,7,13-17H2,2-5H3,(H,27,32) |
| InChIKey | RFMPDSHANCTDMA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|