C12H25NS — CID 166020057
3,4,5-tri(propan-2-yl)-1,3-thiazolidine (PubChem CID 166020057) has the molecular formula C12H25NS and a molecular weight of 215.41 g/mol. Its IUPAC name is 3,4,5-tri(propan-2-yl)-1,3-thiazolidine.
| Compound Name | 3,4,5-tri(propan-2-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 166020057 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3,4,5-tri(propan-2-yl)-1,3-thiazolidine |
| SMILES | CC(C)C1SCN(C(C)C)C1C(C)C |
| InChI | InChI=1S/C12H25NS/c1-8(2)11-12(9(3)4)14-7-13(11)10(5)6/h8-12H,7H2,1-6H3 |
| InChIKey | TZQQVSBIUULERV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |