C6H14N2S — CID 174321953
(2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine (PubChem CID 174321953) has the molecular formula C6H14N2S and a molecular weight of 146.26 g/mol. Its IUPAC name is (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine.
| Compound Name | (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine |
|---|---|
| PubChem CID | 174321953 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine |
| SMILES | CC(C)[C@H]1NN(C)CS1 |
| InChI | InChI=1S/C6H14N2S/c1-5(2)6-7-8(3)4-9-6/h5-7H,4H2,1-3H3/t6-/m0/s1 |
| InChIKey | IDGJFQGEKQIXIL-LURJTMIESA-N |
| XLogP | 1.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |