About (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine
(2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine (PubChem CID 174321953) has the molecular formula C6H14N2S
and a molecular weight of 146.26 g/mol. Its IUPAC name is (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine.
Molecular Properties
| Compound Name | (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine |
| PubChem CID | 174321953 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine |
| SMILES | CC(C)[C@H]1NN(C)CS1 |
| InChI | InChI=1S/C6H14N2S/c1-5(2)6-7-8(3)4-9-6/h5-7H,4H2,1-3H3/t6-/m0/s1 |
| InChIKey | IDGJFQGEKQIXIL-LURJTMIESA-N |
| XLogP | 1.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine?
The IUPAC name of (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine (CID 174321953) is (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine.
What is the SMILES notation for (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine?
The canonical SMILES for (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine is CC(C)[C@H]1NN(C)CS1.
What is the InChIKey of (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine?
The InChIKey is IDGJFQGEKQIXIL-LURJTMIESA-N. The full InChI is InChI=1S/C6H14N2S/c1-5(2)6-7-8(3)4-9-6/h5-7H,4H2,1-3H3/t6-/m0/s1.
What are the key properties of (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine?
(2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine has a molecular weight of 146.26 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methyl-2-propan-2-yl-1,3,4-thiadiazolidine is sourced from PubChem (CID 174321953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).