C16H19ClF3N3O3 — CID 166030932
[3-chloro-4-[methyl(4,4,4-trifluorobutyl)carbamoyl]anilino] azetidine-1-carboxylate (PubChem CID 166030932) has the molecular formula C16H19ClF3N3O3 and a molecular weight of 393.79 g/mol. Its IUPAC name is [3-chloro-4-[methyl(4,4,4-trifluorobutyl)carbamoyl]anilino] azetidine-1-carboxylate.
| Compound Name | [3-chloro-4-[methyl(4,4,4-trifluorobutyl)carbamoyl]anilino] azetidine-1-carboxylate |
|---|---|
| PubChem CID | 166030932 |
| Molecular Formula | C16H19ClF3N3O3 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [3-chloro-4-[methyl(4,4,4-trifluorobutyl)carbamoyl]anilino] azetidine-1-carboxylate |
| SMILES | CN(CCCC(F)(F)F)C(=O)c1ccc(NOC(=O)N2CCC2)cc1Cl |
| InChI | InChI=1S/C16H19ClF3N3O3/c1-22(7-2-6-16(18,19)20)14(24)12-5-4-11(10-13(12)17)21-26-15(25)23-8-3-9-23/h4-5,10,21H,2-3,6-9H2,1H3 |
| InChIKey | SRJFQSGYMVGSJE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|