C18H24O5 — CID 166036527
2,5-bis[1-(oxiran-2-ylmethoxy)but-3-enyl]furan (PubChem CID 166036527) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2,5-bis[1-(oxiran-2-ylmethoxy)but-3-enyl]furan.
| Compound Name | 2,5-bis[1-(oxiran-2-ylmethoxy)but-3-enyl]furan |
|---|---|
| PubChem CID | 166036527 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2,5-bis[1-(oxiran-2-ylmethoxy)but-3-enyl]furan |
| SMILES | C=CCC(OCC1CO1)c1ccc(C(CC=C)OCC2CO2)o1 |
| InChI | InChI=1S/C18H24O5/c1-3-5-15(21-11-13-9-19-13)17-7-8-18(23-17)16(6-4-2)22-12-14-10-20-14/h3-4,7-8,13-16H,1-2,5-6,9-12H2 |
| InChIKey | IYOHDMRZVHLBRO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|