C29H27FNOS+ — CID 166037966
2-[6-(5-cyclohexylthiophen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166037966) has the molecular formula C29H27FNOS+ and a molecular weight of 456.61 g/mol. Its IUPAC name is 2-[6-(5-cyclohexylthiophen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(5-cyclohexylthiophen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166037966 |
| Molecular Formula | C29H27FNOS+ |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[6-(5-cyclohexylthiophen-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C5CCCCC5)s4)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C29H27FNOS/c1-18-11-12-20-21-13-14-22(30)27(25-16-15-24(33-25)19-8-4-3-5-9-19)29(21)32-28(20)26(18)23-10-6-7-17-31(23)2/h6-7,10-17,19H,3-5,8-9H2,1-2H3/q+1 |
| InChIKey | JMKPFLXSITYKQT-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|