C38H41N2O+ — CID 166038336
4-[4-(4-tert-butyl-1-deuteriocyclohexyl)phenyl]-6-(1-methyl-4-propan-2-ylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 166038336) has the molecular formula C38H41N2O+ and a molecular weight of 542.77 g/mol. Its IUPAC name is 4-[4-(4-tert-butyl-1-deuteriocyclohexyl)phenyl]-6-(1-methyl-4-propan-2-ylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 4-[4-(4-tert-butyl-1-deuteriocyclohexyl)phenyl]-6-(1-methyl-4-propan-2-ylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166038336 |
| Molecular Formula | C38H41N2O+ |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 4-[4-(4-tert-butyl-1-deuteriocyclohexyl)phenyl]-6-(1-methyl-4-propan-2-ylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | [2H]C1(c2ccc(-c3c(C#N)ccc4c3oc3c(-c5cc(C(C)C)cc[n+]5C)cccc34)cc2)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C38H41N2O/c1-24(2)28-20-21-40(6)34(22-28)33-9-7-8-31-32-19-16-29(23-39)35(37(32)41-36(31)33)27-12-10-25(11-13-27)26-14-17-30(18-15-26)38(3,4)5/h7-13,16,19-22,24,26,30H,14-15,17-18H2,1-6H3/q+1/i26D |
| InChIKey | GIGNTVOEBBLJMI-HKAOEGRMSA-N |
| XLogP | 10.06 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|