C37H37N2O+ — CID 166038421
4-[4-(2-deuterio-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)phenyl]-6-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]dibenzofuran-3-carbonitrile (PubChem CID 166038421) has the molecular formula C37H37N2O+ and a molecular weight of 532.76 g/mol. Its IUPAC name is 4-[4-(2-deuterio-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)phenyl]-6-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]dibenzofuran-3-carbonitrile.
| Compound Name | 4-[4-(2-deuterio-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)phenyl]-6-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166038421 |
| Molecular Formula | C37H37N2O+ |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | 4-[4-(2-deuterio-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)phenyl]-6-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]dibenzofuran-3-carbonitrile |
| SMILES | [2H]C([2H])([2H])c1cc(-c2cccc3c2oc2c(-c4ccc(C5([2H])CCC6CCCCC6C5)cc4)c(C#N)ccc23)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C37H37N2O/c1-23-19-34(39(3)22-24(23)2)33-10-6-9-31-32-18-17-30(21-38)35(37(32)40-36(31)33)27-14-11-26(12-15-27)29-16-13-25-7-4-5-8-28(25)20-29/h6,9-12,14-15,17-19,22,25,28-29H,4-5,7-8,13,16,20H2,1-3H3/q+1/i1D3,2D3,29D |
| InChIKey | XYENMAPOSWASBH-CNGWXJCKSA-N |
| XLogP | 9.31 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|