C26H24N4O4S — CID 166039881
N-[3-[1-[(2-amino-5-pyridin-3-yl-3-pyridinyl)oxy]ethyl]phenyl]-3-methylsulfonylbenzamide (PubChem CID 166039881) has the molecular formula C26H24N4O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is N-[3-[1-[(2-amino-5-pyridin-3-yl-3-pyridinyl)oxy]ethyl]phenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[3-[1-[(2-amino-5-pyridin-3-yl-3-pyridinyl)oxy]ethyl]phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 166039881 |
| Molecular Formula | C26H24N4O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | N-[3-[1-[(2-amino-5-pyridin-3-yl-3-pyridinyl)oxy]ethyl]phenyl]-3-methylsulfonylbenzamide |
| SMILES | CC(Oc1cc(-c2cccnc2)cnc1N)c1cccc(NC(=O)c2cccc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C26H24N4O4S/c1-17(34-24-14-21(16-29-25(24)27)20-8-5-11-28-15-20)18-6-3-9-22(12-18)30-26(31)19-7-4-10-23(13-19)35(2,32)33/h3-17H,1-2H3,(H2,27,29)(H,30,31) |
| InChIKey | PMAHZVAGXZQERH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |