C21H19ClFN3O2 — CID 166039897
N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-4-fluoro-3-methylbenzamide (PubChem CID 166039897) has the molecular formula C21H19ClFN3O2 and a molecular weight of 399.85 g/mol. Its IUPAC name is N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-4-fluoro-3-methylbenzamide.
| Compound Name | N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 166039897 |
| Molecular Formula | C21H19ClFN3O2 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-4-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(C)Oc3cc(Cl)cnc3N)c2)ccc1F |
| InChI | InChI=1S/C21H19ClFN3O2/c1-12-8-15(6-7-18(12)23)21(27)26-17-5-3-4-14(9-17)13(2)28-19-10-16(22)11-25-20(19)24/h3-11,13H,1-2H3,(H2,24,25)(H,26,27) |
| InChIKey | OCZHQVUYNBRDLI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |