C24H21ClN4O2 — CID 166039838
N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-(1-cyanocyclopropyl)benzamide (PubChem CID 166039838) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-(1-cyanocyclopropyl)benzamide.
| Compound Name | N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-(1-cyanocyclopropyl)benzamide |
|---|---|
| PubChem CID | 166039838 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-(1-cyanocyclopropyl)benzamide |
| SMILES | CC(Oc1cc(Cl)cnc1N)c1cccc(NC(=O)c2cccc(C3(C#N)CC3)c2)c1 |
| InChI | InChI=1S/C24H21ClN4O2/c1-15(31-21-12-19(25)13-28-22(21)27)16-4-3-7-20(11-16)29-23(30)17-5-2-6-18(10-17)24(14-26)8-9-24/h2-7,10-13,15H,8-9H2,1H3,(H2,27,28)(H,29,30) |
| InChIKey | DCKKZLAIWIECQJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |