C24H21ClN4O2 — CID 166039827
N-[3-[(1R)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-(1-isocyanocyclopropyl)benzamide (PubChem CID 166039827) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is N-[3-[(1R)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-(1-isocyanocyclopropyl)benzamide.
| Compound Name | N-[3-[(1R)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-(1-isocyanocyclopropyl)benzamide |
|---|---|
| PubChem CID | 166039827 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[3-[(1R)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-(1-isocyanocyclopropyl)benzamide |
| SMILES | [C-]#[N+]C1(c2cccc(C(=O)Nc3cccc([C@@H](C)Oc4cc(Cl)cnc4N)c3)c2)CC1 |
| InChI | InChI=1S/C24H21ClN4O2/c1-15(31-21-13-19(25)14-28-22(21)26)16-5-4-8-20(12-16)29-23(30)17-6-3-7-18(11-17)24(27-2)9-10-24/h3-8,11-15H,9-10H2,1H3,(H2,26,28)(H,29,30)/t15-/m1/s1 |
| InChIKey | VJXYOOVOXABFEY-OAHLLOKOSA-N |
| XLogP | 5.62 |
| TPSA | 81.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|