C21H20ClN3O3 — CID 139489368
N-[3-[(1R)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-methoxybenzamide (PubChem CID 139489368) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is N-[3-[(1R)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-methoxybenzamide.
| Compound Name | N-[3-[(1R)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 139489368 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[3-[(1R)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc([C@@H](C)Oc3cc(Cl)cnc3N)c2)c1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-13(28-19-11-16(22)12-24-20(19)23)14-5-3-7-17(9-14)25-21(26)15-6-4-8-18(10-15)27-2/h3-13H,1-2H3,(H2,23,24)(H,25,26)/t13-/m1/s1 |
| InChIKey | YWCIBALKLKFTEY-CYBMUJFWSA-N |
| XLogP | 4.72 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |