C21H17ClN4O2 — CID 163204610
3-[(1S)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]-N-(3-cyanophenyl)benzamide (PubChem CID 163204610) has the molecular formula C21H17ClN4O2 and a molecular weight of 392.85 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]-N-(3-cyanophenyl)benzamide.
| Compound Name | 3-[(1S)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]-N-(3-cyanophenyl)benzamide |
|---|---|
| PubChem CID | 163204610 |
| Molecular Formula | C21H17ClN4O2 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-[(1S)-1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]-N-(3-cyanophenyl)benzamide |
| SMILES | C[C@H](Oc1cc(Cl)cnc1N)c1cccc(C(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C21H17ClN4O2/c1-13(28-19-10-17(22)12-25-20(19)24)15-5-3-6-16(9-15)21(27)26-18-7-2-4-14(8-18)11-23/h2-10,12-13H,1H3,(H2,24,25)(H,26,27)/t13-/m0/s1 |
| InChIKey | QHWLSLNGKKHRSI-ZDUSSCGKSA-N |
| XLogP | 4.58 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |