C22H22ClN4O2+ — CID 175475482
N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-cyclopropylpyridin-1-ium-1-carboxamide (PubChem CID 175475482) has the molecular formula C22H22ClN4O2+ and a molecular weight of 409.90 g/mol. Its IUPAC name is N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-cyclopropylpyridin-1-ium-1-carboxamide.
| Compound Name | N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-cyclopropylpyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 175475482 |
| Molecular Formula | C22H22ClN4O2+ |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[3-[1-[(2-amino-5-chloro-3-pyridinyl)oxy]ethyl]phenyl]-3-cyclopropylpyridin-1-ium-1-carboxamide |
| SMILES | CC(Oc1cc(Cl)cnc1N)c1cccc(NC(=O)[n+]2cccc(C3CC3)c2)c1 |
| InChI | InChI=1S/C22H21ClN4O2/c1-14(29-20-11-18(23)12-25-21(20)24)16-4-2-6-19(10-16)26-22(28)27-9-3-5-17(13-27)15-7-8-15/h2-6,9-15H,7-8H2,1H3,(H2-,24,25,26,28)/p+1 |
| InChIKey | KAICJISFQADZTO-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|