C18H20ClF4N3O3 — CID 166045479
2-[(S)-(3-chloro-2,4-difluorophenyl)-[3-(difluoromethoxy)cyclobutyl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide (PubChem CID 166045479) has the molecular formula C18H20ClF4N3O3 and a molecular weight of 437.82 g/mol. Its IUPAC name is 2-[(S)-(3-chloro-2,4-difluorophenyl)-[3-(difluoromethoxy)cyclobutyl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide.
| Compound Name | 2-[(S)-(3-chloro-2,4-difluorophenyl)-[3-(difluoromethoxy)cyclobutyl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 166045479 |
| Molecular Formula | C18H20ClF4N3O3 |
| Molecular Weight | 437.82 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-[(S)-(3-chloro-2,4-difluorophenyl)-[3-(difluoromethoxy)cyclobutyl]methyl]-2-methyl-3-oxopiperazine-1-carboxamide |
| SMILES | CC1([C@H](c2ccc(F)c(Cl)c2F)C2CC(OC(F)F)C2)C(=O)NCCN1C(N)=O |
| InChI | InChI=1S/C18H20ClF4N3O3/c1-18(15(27)25-4-5-26(18)17(24)28)12(8-6-9(7-8)29-16(22)23)10-2-3-11(20)13(19)14(10)21/h2-3,8-9,12,16H,4-7H2,1H3,(H2,24,28)(H,25,27)/t8?,9?,12-,18?/m0/s1 |
| InChIKey | UCZYRCVKWKYERV-MOFJHHPOSA-N |
| XLogP | 2.99 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|