About 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine
6-(4-fluorophenyl)-1,2,2-trimethylpiperazine (PubChem CID 166046489) has the molecular formula C13H19FN2
and a molecular weight of 222.31 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine |
| PubChem CID | 166046489 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine |
| SMILES | CN1C(c2ccc(F)cc2)CNCC1(C)C |
| InChI | InChI=1S/C13H19FN2/c1-13(2)9-15-8-12(16(13)3)10-4-6-11(14)7-5-10/h4-7,12,15H,8-9H2,1-3H3 |
| InChIKey | CQRUFXNPZSBLII-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine?
The IUPAC name of 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine (CID 166046489) is 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine.
What is the SMILES notation for 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine?
The canonical SMILES for 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine is CN1C(c2ccc(F)cc2)CNCC1(C)C.
What is the InChIKey of 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine?
The InChIKey is CQRUFXNPZSBLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2/c1-13(2)9-15-8-12(16(13)3)10-4-6-11(14)7-5-10/h4-7,12,15H,8-9H2,1-3H3.
What are the key properties of 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine?
6-(4-fluorophenyl)-1,2,2-trimethylpiperazine has a molecular weight of 222.31 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine is sourced from PubChem (CID 166046489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).