C13H19FN2 — CID 166046489
6-(4-fluorophenyl)-1,2,2-trimethylpiperazine (PubChem CID 166046489) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine.
| Compound Name | 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine |
|---|---|
| PubChem CID | 166046489 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 6-(4-fluorophenyl)-1,2,2-trimethylpiperazine |
| SMILES | CN1C(c2ccc(F)cc2)CNCC1(C)C |
| InChI | InChI=1S/C13H19FN2/c1-13(2)9-15-8-12(16(13)3)10-4-6-11(14)7-5-10/h4-7,12,15H,8-9H2,1-3H3 |
| InChIKey | CQRUFXNPZSBLII-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |