About 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide
1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide (PubChem CID 166048101) has the molecular formula C12H14FN3O3
and a molecular weight of 267.26 g/mol. Its IUPAC name is 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide |
| PubChem CID | 166048101 |
| Molecular Formula | C12H14FN3O3 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC[C@H](O)CO)c2c(F)cccc12 |
| InChI | InChI=1S/C12H14FN3O3/c13-9-3-1-2-8-10(12(14)19)15-16(11(8)9)5-4-7(18)6-17/h1-3,7,17-18H,4-6H2,(H2,14,19)/t7-/m0/s1 |
| InChIKey | DFZWGCROTORAID-ZETCQYMHSA-N |
| XLogP | 0.02 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide?
The IUPAC name of 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide (CID 166048101) is 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide.
What is the SMILES notation for 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide?
The canonical SMILES for 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide is NC(=O)c1nn(CC[C@H](O)CO)c2c(F)cccc12.
What is the InChIKey of 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide?
The InChIKey is DFZWGCROTORAID-ZETCQYMHSA-N. The full InChI is InChI=1S/C12H14FN3O3/c13-9-3-1-2-8-10(12(14)19)15-16(11(8)9)5-4-7(18)6-17/h1-3,7,17-18H,4-6H2,(H2,14,19)/t7-/m0/s1.
What are the key properties of 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide?
1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide has a molecular weight of 267.26 g/mol, XLogP of 0.02, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3,4-dihydroxybutyl]-7-fluoroindazole-3-carboxamide is sourced from PubChem (CID 166048101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).