C44H29AuN2O2 — CID 166050797
10-[3-[[9,9-dimethyl-2-(6-phenyl-2-pyridinyl)-3H-fluoren-3-id-4-yl]oxy]benzene-4-id-1-yl]phenoxazine;gold(3+) (PubChem CID 166050797) has the molecular formula C44H29AuN2O2 and a molecular weight of 814.70 g/mol. Its IUPAC name is 10-[3-[[9,9-dimethyl-2-(6-phenyl-2-pyridinyl)-3H-fluoren-3-id-4-yl]oxy]benzene-4-id-1-yl]phenoxazine;gold(3+).
| Compound Name | 10-[3-[[9,9-dimethyl-2-(6-phenyl-2-pyridinyl)-3H-fluoren-3-id-4-yl]oxy]benzene-4-id-1-yl]phenoxazine;gold(3+) |
|---|---|
| PubChem CID | 166050797 |
| Molecular Formula | C44H29AuN2O2 |
| Molecular Weight | 814.70 g/mol |
| Exact Mass | 814.19 |
| IUPAC Name | 10-[3-[[9,9-dimethyl-2-(6-phenyl-2-pyridinyl)-3H-fluoren-3-id-4-yl]oxy]benzene-4-id-1-yl]phenoxazine;gold(3+) |
| SMILES | CC1(C)c2ccccc2-c2c(Oc3[c-]ccc(N4c5ccccc5Oc5ccccc54)c3)[c-]c(-c3cccc(-c4[c-]cccc4)n3)cc21.[Au+3] |
| InChI | InChI=1S/C44H29N2O2.Au/c1-44(2)34-19-7-6-18-33(34)43-35(44)26-30(37-21-13-20-36(45-37)29-14-4-3-5-15-29)27-42(43)47-32-17-12-16-31(28-32)46-38-22-8-10-24-40(38)48-41-25-11-9-23-39(41)46;/h3-14,16,18-26,28H,1-2H3;/q-3;+3 |
| InChIKey | WRPGMHBBLBXCRF-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.70 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|