C30H41O4- — CID 166056724
methyl 2-methanidyl-2,6-dimethyl-4-[3-(oxan-2-yloxymethyl)phenyl]-4-phenyloctanoate (PubChem CID 166056724) has the molecular formula C30H41O4- and a molecular weight of 465.65 g/mol. Its IUPAC name is methyl 2-methanidyl-2,6-dimethyl-4-[3-(oxan-2-yloxymethyl)phenyl]-4-phenyloctanoate.
| Compound Name | methyl 2-methanidyl-2,6-dimethyl-4-[3-(oxan-2-yloxymethyl)phenyl]-4-phenyloctanoate |
|---|---|
| PubChem CID | 166056724 |
| Molecular Formula | C30H41O4- |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | methyl 2-methanidyl-2,6-dimethyl-4-[3-(oxan-2-yloxymethyl)phenyl]-4-phenyloctanoate |
| SMILES | [CH2-]C(C)(CC(CC(C)CC)(c1ccccc1)c1cccc(COC2CCCCO2)c1)C(=O)OC |
| InChI | InChI=1S/C30H41O4/c1-6-23(2)20-30(25-14-8-7-9-15-25,22-29(3,4)28(31)32-5)26-16-12-13-24(19-26)21-34-27-17-10-11-18-33-27/h7-9,12-16,19,23,27H,3,6,10-11,17-18,20-22H2,1-2,4-5H3/q-1 |
| InChIKey | DBTIGEZALZKSQD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|