C21H21NO8 — CID 166057428
(2S)-2-[[4-[(2-formyl-3-hydroxyphenoxy)methyl]benzoyl]amino]-5-formyloxypentanoic acid (PubChem CID 166057428) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-formyl-3-hydroxyphenoxy)methyl]benzoyl]amino]-5-formyloxypentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-formyl-3-hydroxyphenoxy)methyl]benzoyl]amino]-5-formyloxypentanoic acid |
|---|---|
| PubChem CID | 166057428 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (2S)-2-[[4-[(2-formyl-3-hydroxyphenoxy)methyl]benzoyl]amino]-5-formyloxypentanoic acid |
| SMILES | O=COCCC[C@H](NC(=O)c1ccc(COc2cccc(O)c2C=O)cc1)C(=O)O |
| InChI | InChI=1S/C21H21NO8/c23-11-16-18(25)4-1-5-19(16)30-12-14-6-8-15(9-7-14)20(26)22-17(21(27)28)3-2-10-29-13-24/h1,4-9,11,13,17,25H,2-3,10,12H2,(H,22,26)(H,27,28)/t17-/m0/s1 |
| InChIKey | LUYVHIFJWJLSRT-KRWDZBQOSA-N |
| XLogP | 1.92 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|