C49H76N2O11 — CID 166059479
bis[2-[(2,2-diheptyl-1,3-dioxolan-4-yl)methyl]-4-nitrophenyl] carbonate (PubChem CID 166059479) has the molecular formula C49H76N2O11 and a molecular weight of 869.15 g/mol. Its IUPAC name is bis[2-[(2,2-diheptyl-1,3-dioxolan-4-yl)methyl]-4-nitrophenyl] carbonate.
| Compound Name | bis[2-[(2,2-diheptyl-1,3-dioxolan-4-yl)methyl]-4-nitrophenyl] carbonate |
|---|---|
| PubChem CID | 166059479 |
| Molecular Formula | C49H76N2O11 |
| Molecular Weight | 869.15 g/mol |
| Exact Mass | 868.54 |
| IUPAC Name | bis[2-[(2,2-diheptyl-1,3-dioxolan-4-yl)methyl]-4-nitrophenyl] carbonate |
| SMILES | CCCCCCCC1(CCCCCCC)OCC(Cc2cc([N+](=O)[O-])ccc2OC(=O)Oc2ccc([N+](=O)[O-])cc2CC2COC(CCCCCCC)(CCCCCCC)O2)O1 |
| InChI | InChI=1S/C49H76N2O11/c1-5-9-13-17-21-29-48(30-22-18-14-10-6-2)57-37-43(61-48)35-39-33-41(50(53)54)25-27-45(39)59-47(52)60-46-28-26-42(51(55)56)34-40(46)36-44-38-58-49(62-44,31-23-19-15-11-7-3)32-24-20-16-12-8-4/h25-28,33-34,43-44H,5-24,29-32,35-38H2,1-4H3 |
| InChIKey | WHWPMXKEVYLHTG-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 158.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.15 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|